A1537212
4-(Bromomethyl)benzoic Acid , ≥97.0% , 6232-88-8
Synonym(s):
α-Bromo-p-toluic acid;α-Bromo-p-toluylic acid;4-(Bromomethyl)benzoic acid
CAS NO.:6232-88-8
Empirical Formula: C8H7BrO2
Molecular Weight: 215.04
MDL number: MFCD00002567
EINECS: 228-343-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB182.40 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| 100G | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 224-229 °C(lit.) |
| Boiling point: | 252.95°C (rough estimate) |
| Density | 1.5313 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Store below +30°C. |
| form | Crystalline Powder |
| pka | 4.10±0.10(Predicted) |
| color | White to beige |
| Water Solubility | Soluble in water. |
| BRN | 1862870 |
| InChI | InChI=1S/C8H7BrO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | CQQSQBRPAJSTFB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(CBr)C=C1 |
| CAS DataBase Reference | 6232-88-8(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 4-(bromomethyl)- (6232-88-8) |
Description and Uses
4-(Bromomethyl)benzoic acid was used in the chemical modification of 5,10,15,20-tetra(m-hydroxyphenyl)chlorin (temoporfin), second generation photosensitizer. It was also used in the synthesis of 4-(5-arylidene-2,4-dioxothiazolidin-3-yl) methylbenzoic acids.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Warning |
| Hazard statements | H318-H314-H315-H319-H335 |
| Precautionary statements | P309-P310-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| F | 19-21 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |








