A1279912
5-Bromo-2-furaldehyde , 98% , 1899-24-7
CAS NO.:1899-24-7
Empirical Formula: C5H3BrO2
Molecular Weight: 174.98
MDL number: MFCD00159501
EINECS: 628-757-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB63.20 | In Stock |
|
| 25G | RMB237.60 | In Stock |
|
| 100g | RMB896.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-85 °C (lit.) |
| Boiling point: | 112 °C/16 mmHg (lit.) |
| Density | 1.5940 (rough estimate) |
| refractive index | 1.4450 (estimate) |
| Flash point: | 112°C/6mm |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol |
| form | Powder |
| color | Slightly yellow |
| Sensitive | Air Sensitive |
| BRN | 108403 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C5H3BrO2/c6-5-2-1-4(3-7)8-5/h1-3H |
| InChIKey | WJTFHWXMITZNHS-UHFFFAOYSA-N |
| SMILES | O1C(Br)=CC=C1C=O |
| CAS DataBase Reference | 1899-24-7(CAS DataBase Reference) |
Description and Uses
5-Bromo-2-furaldehyde is used in the preparation of isoindolinones from furfural. Also used in the preparation of brominated nitrovinylfuran which displays antibacterial activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





