A1688012
5-Bromobenzofuran , 97% , 23145-07-5
Synonym(s):
5-Bromobenzo[b]furan
| Pack Size | Price | Stock | Quantity |
| 1G | RMB53.60 | In Stock |
|
| 5g | RMB180.00 | In Stock |
|
| 25g | RMB588.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 8°C(lit.) |
| Boiling point: | 226°C(lit.) |
| Density | 1.573 g/mL at 25 °C |
| refractive index | n20/D1.605 |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Colourless to light yellow |
| InChI | InChI=1S/C8H5BrO/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H |
| InChIKey | AYOVPQORFBWFNO-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(Br)C=C2C=C1 |
| CAS DataBase Reference | 23145-07-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzofuran, 5-bromo- (23145-07-5) |
Description and Uses
5-Bromobenzofuran is used in the synthesis of 1-(7-benzofuranyl)-4-methylpiperazine; a compound shown to bind strongly and with high selectivity to the serotonin receptor 5-HT2A in the presence of the receptor 5-HT7 in vitro.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H351 |
| Precautionary statements | P201-P301+P312+P330-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29329990 |
