A1280012
Benzo-15-crown-5 , 98% , 14098-44-3
CAS NO.:14098-44-3
Empirical Formula: C14H20O5
Molecular Weight: 268.31
MDL number: MFCD00005945
EINECS: 237-947-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB102.40 | In Stock |
|
| 5G | RMB388.00 | In Stock |
|
| 25G | RMB1892.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-80 °C (lit.) |
| Boiling point: | 371.47°C (rough estimate) |
| Density | 1.1846 (rough estimate) |
| refractive index | 1.4825 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder or Flakes |
| color | Almost white to light gray |
| Water Solubility | partially soluble |
| Sensitive | Hygroscopic |
| BRN | 1624106 |
| InChI | InChI=1S/C14H20O5/c1-2-4-14-13(3-1)18-11-9-16-7-5-15-6-8-17-10-12-19-14/h1-4H,5-12H2 |
| InChIKey | DSFHXKRFDFROER-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2OCCOCCOCCOCC1 |
| CAS DataBase Reference | 14098-44-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Bis(1,4,7,10,13-benzopentaoxacyclopentadecin, 2,3,5,6,8,9,11,12-octahydro-)(14098-44-3) |
Description and Uses
Benzo-15-crown-5 is used in synthetic chemistry. It plays a major role and involved in complexation through ether oxygen. It is used in phase-transfer catalyst system. It is involved in 'Host-Guest' chemistry to identify the move of essential elements in the body. It can play the part of very complicated biological reactions such as enzyme functions, which finds application in the development of new pharmaceuticals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | DI5400000 |
| F | 3-10 |
| Hazard Note | Irritant |
| HS Code | 29329995 |





![Benzo[b]thiophene](https://img.chemicalbook.com/CAS/GIF/95-15-8.gif)
