A1284312
Nα-Boc-L-Asparagine 4-nitrophenyl ester , ≥98.0%(HPLC) , 4587-33-1
CAS NO.:4587-33-1
Empirical Formula: C15H19N3O7
Molecular Weight: 353.33
MDL number: MFCD00037279
EINECS: 237-294-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.00 | In Stock |
|
| 5G | RMB99.20 | In Stock |
|
| 25G | RMB402.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-118 °C(lit.) |
| Boiling point: | 609.3±55.0 °C(Predicted) |
| Density | 1.318±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | slightly sol. in Methanol |
| pka | 10.57±0.46(Predicted) |
| form | Powder |
| color | White to off-white |
| InChI | InChI=1S/C15H19N3O7/c1-15(2,3)25-14(21)17-11(8-12(16)19)13(20)24-10-6-4-9(5-7-10)18(22)23/h4-7,11H,8H2,1-3H3,(H2,16,19)(H,17,21)/t11-/m0/s1 |
| InChIKey | IAPXDJMULQXGDD-NSHDSACASA-N |
| SMILES | C(OC1=CC=C([N+]([O-])=O)C=C1)(=O)[C@H](CC(N)=O)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 4587-33-1(CAS DataBase Reference) |
| EPA Substance Registry System | L-Asparagine, N2-[(1,1-dimethylethoxy)carbonyl]-, 4-nitrophenyl ester (4587-33-1) |
Description and Uses
Boc-Asn-ONp, is an Asparagine derivative used in peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 8 |
| TSCA | TSCA listed |
| HS Code | 29242990 |







