A1271212
Boc-L-Asp(OcHex)OH , 99% , 73821-95-1
Synonym(s):
Boc-L -aspartic acid 4-cyclohexyl ester
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB80.80 | In Stock |
|
| 25G | RMB236.00 | In Stock |
|
| 100G | RMB630.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-95 °C |
| Boiling point: | 487.2±40.0 °C(Predicted) |
| Density | 1.18±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 3.66±0.23(Predicted) |
| color | White |
| optical activity | [α]20/D 21.0±1.5°, c = 2% in DMF |
| BRN | 3563576 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H25NO6/c1-15(2,3)22-14(20)16-11(13(18)19)9-12(17)21-10-7-5-4-6-8-10/h10-11H,4-9H2,1-3H3,(H,16,20)(H,18,19)/t11-/m0/s1 |
| InChIKey | NLPQIWFEEKQBBN-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OC1CCCCC1)C(O)=O |
| CAS DataBase Reference | 73821-95-1(CAS DataBase Reference) |
Description and Uses
Boc-L-Asp(OcHx)-OH, is an aspartic acid derivative, that can be used in various chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
