A1228312
Boc-Asp(OtBu)-OH , 98% , 1676-90-0
Synonym(s):
Boc-L -aspartic acid 4-tert-butyl ester
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB52.80 | In Stock |
|
| 25G | RMB230.40 | In Stock |
|
| 100G | RMB750.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-67 °C |
| alpha | 2 º (c=1% in MeOH) |
| Boiling point: | 432.6±40.0 °C(Predicted) |
| Density | 1.139±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in methanol and dimethyl sulfoxide. |
| pka | 3.69±0.23(Predicted) |
| form | Powder |
| color | White |
| optical activity | [α]20/D +2.0±0.4°, c = 1% in methanol |
| BRN | 2336144 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C13H23NO6/c1-12(2,3)19-9(15)7-8(10(16)17)14-11(18)20-13(4,5)6/h8H,7H2,1-6H3,(H,14,18)(H,16,17)/t8-/m0/s1 |
| InChIKey | PHJDCONJXLIIPW-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](CC(OC(C)(C)C)=O)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 1676-90-0(CAS DataBase Reference) |
Description and Uses
It is used in the preparation of highly selective thrombin inhibitors. Also used in the preparation of thiopeptides and thioacylating agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |







