A1301812
Boc-L-glutamic acid 5-cyclohexyl ester , 98% , 73821-97-3
Synonym(s):
Boc-Glu(OcHx)-OH;N-α-t.-Boc-L-glutamic acid γ-cyclohexyl ester
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB60.80 | In Stock |
|
| 25G | RMB264.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-57 °C |
| Boiling point: | 502.6±45.0 °C(Predicted) |
| Density | 1.16±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 3.79±0.10(Predicted) |
| form | Solid |
| color | White to Almost white |
| optical activity | -7.5° (C=0.01 g/100ml, ACOH) |
| Major Application | peptide synthesis |
| InChI | 1S/C16H27NO6/c1-16(2,3)23-15(21)17-12(14(19)20)9-10-13(18)22-11-7-5-4-6-8-11/h11-12H,4-10H2,1-3H3,(H,17,21)(H,19,20)/t12-/m0/s1 |
| InChIKey | FDNMLANBNJDIRG-LBPRGKRZSA-N |
| SMILES | N([C@@H](CCC(=O)OC1CCCCC1)C(=O)O)C(=O)OC(C)(C)C |
| CAS DataBase Reference | 73821-97-3(CAS DataBase Reference) |
Description and Uses
This side-chain protecting group for glutamic acid, Boc-L-glutamic acid 5-cyclohexyl ester is used to minimize side reactions during acidic and basic treatments
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| Storage Class | 11 - Combustible Solids |
