A1228512
N-Boc-L-glutamic acid 5-tert-butyl ester , 98% , 13726-84-6
Synonym(s):
Boc-L -glutamic acid 5-tert-butyl ester;Boc-Glu(OtBu)-OH;N-α-t.-Boc-L-glutamic acid γ-t.-butyl ester
| Pack Size | Price | Stock | Quantity |
| 5G | RMB52.00 | In Stock |
|
| 25G | RMB225.60 | In Stock |
|
| 100G | RMB785.60 | In Stock |
|
| 500g | RMB3062.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-105 °C |
| Boiling point: | 449.8±40.0 °C(Predicted) |
| Density | 1.121±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.82±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D 9.5±1°, c = 1% in methanol |
| BRN | 2149791 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H25NO6/c1-13(2,3)20-10(16)8-7-9(11(17)18)15-12(19)21-14(4,5)6/h9H,7-8H2,1-6H3,(H,15,19)(H,17,18)/t9-/m0/s1 |
| InChIKey | YGSRAYJBEREVRB-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(O)=O |
| CAS DataBase Reference | 13726-84-6(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2924 19 00 |
| Storage Class | 11 - Combustible Solids |
