BD0043348
Boc-Arg(Tos)-OH , 98% , 13836-37-8
Synonym(s):
Nα-Boc-Nω-tosyl-L -arginine;Boc-Arg(Tos)-OH;N-α-t.-Boc-N G-tosyl-L-arginine
CAS NO.:13836-37-8
Empirical Formula: C18H28N4O6S
Molecular Weight: 428.5
MDL number: MFCD04974532
EINECS: 237-549-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB89.60 | In Stock |
|
| 25g | RMB243.20 | In Stock |
|
| 100g | RMB794.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~90 °C (dec.) |
| alpha | -3.5 º (c=4% in DMF) |
| Density | 1.31±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in water or 1% acetic acid |
| pka | 3.95±0.21(Predicted) |
| form | Powder |
| color | White to off-white |
| optical activity | [α]20/D 3.5±0.5°, c = 4% in DMF |
| BRN | 2683538 |
| Major Application | peptide synthesis |
| InChIKey | WBIIPXYJAMICNU-AWEZNQCLSA-N |
| SMILES | Cc1ccc(cc1)S(=O)(=O)NC(=N)NCCC[C@H](NC(=O)OC(C)(C)C)C(O)=O |
| CAS DataBase Reference | 13836-37-8(CAS DataBase Reference) |
| EPA Substance Registry System | L-Ornithine, N2-[(1,1-dimethylethoxy)carbonyl]-N5-[imino[[(4-methylphenyl)sulfonyl]amino]methyl]- (13836-37-8) |
Description and Uses
Boc-Arg(Tos)-OH, is an arginine derivative and a building block used in peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264b-P270-P301+P312-P330-P403-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2935 90 90 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |







