A1287312
2,2'-Biphenyldicarboxylic Acid , 98% , 482-05-3
Synonym(s):
2,2′-Biphenyldicarboxylic acid;Biphenyl-2,2′-dicarboxylic acid;Diphenic acid, Diphenyl-2,2-dicarboxylic acid
CAS NO.:482-05-3
Empirical Formula: C14H10O4
Molecular Weight: 242.23
MDL number: MFCD00002464
EINECS: 207-576-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB39.20 | In Stock |
|
| 25G | RMB166.40 | In Stock |
|
| 100G | RMB527.20 | In Stock |
|
| 250g | RMB1279.20 | In Stock |
|
| 500G | RMB2396.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 227-229 °C(lit.) |
| Boiling point: | 345.05°C (rough estimate) |
| Density | 1.2695 (rough estimate) |
| bulk density | 470kg/m3 |
| refractive index | 1.5389 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | pKa 3.20(H2O t=23.0) (Uncertain);5.06(H2O t=23.0) (Uncertain) |
| color | White to Orange to Green |
| PH | 4-5 (H2O, 20℃) |
| Water Solubility | insoluble (20 ºC) |
| Merck | 14,3310 |
| BRN | 2053625 |
| InChI | 1S/C14H10O4/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18/h1-8H,(H,15,16)(H,17,18) |
| InChIKey | GWZCCUDJHOGOSO-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccccc1-c2ccccc2C(O)=O |
| CAS DataBase Reference | 482-05-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,2'-Biphenyldicarboxylic acid(482-05-3) |
| EPA Substance Registry System | [1,1'-Biphenyl]-2,2'-dicarboxylic acid (482-05-3) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-37 |
| WGK Germany | 3 |
| Autoignition Temperature | 390 °C |
| TSCA | TSCA listed |
| HS Code | 29173980 |
| Storage Class | 11 - Combustible Solids |







