Biphenyl-4,4′-dicarboxylic acid , 97% , 787-70-2
Synonym(s):
4,4′-Bibenzoic acid;4,4′-Dicarboxybiphenyl;4,4′-Diphenyldicarboxylic acid
CAS NO.:787-70-2
Empirical Formula: C14H10O4
Molecular Weight: 242.23
MDL number: MFCD00002554
EINECS: 212-328-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB62.40 | In Stock |
|
| 100G | RMB252.80 | In Stock |
|
| 250G | RMB527.20 | In Stock |
|
| 500g | RMB960.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 482.5±38.0 °C(Predicted) |
| Density | 1.347±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.77±0.10(Predicted) |
| form | Powder |
| color | White to light beige |
| BRN | 523308 |
| InChI | InChI=1S/C14H10O4/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18/h1-8H,(H,15,16)(H,17,18) |
| InChIKey | NEQFBGHQPUXOFH-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(C(O)=O)C=C2)=CC=C(C(O)=O)C=C1 |
| CAS DataBase Reference | 787-70-2(CAS DataBase Reference) |
| EPA Substance Registry System | [1,1'-Biphenyl]-4,4'-dicarboxylic acid (787-70-2) |
Description and Uses
Biphenyl-4,4′-dicarboxylic acid (BPDC) belongs to the class of monomers known as aromatic dicarboxylic acids. It is used to prepare BPDC-based polymers, which exhibit excellent thermal stability, making them suitable for applications where high-temperature resistance is required. These polymers also demonstrate high electrical insulation properties due to their low dielectric constant and high breakdown strength. They find applications in the electrical and electronics industry for insulation, encapsulation, and fabrication of high-performance electronic devices.
Dendrimer building block.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| RTECS | DV2975000 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![[1,1'-Biphenyl]-3,3',5,5'-tetracarbaldehyde](https://img.chemicalbook.com/CAS/20180529/GIF/150443-85-9.gif)

