A1198612
4,4'-Bis(chloromethyl)biphenyl , 96% , 1667-10-3
CAS NO.：1667-10-3
Empirical Formula: C14H12Cl2
Molecular Weight: 251.15
MDL number: MFCD00674019
EINECS: 216-784-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB69.60 | In Stock |
|
| 250g | RMB159.20 | In Stock |
|
| 500G | RMB248.00 | In Stock |
|
| 2.5KG | RMB1076.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126 °C (dec.)(lit.) |
| Boiling point: | 184 °C / 0.2mmHg |
| Density | 1.195±0.06 g/cm3(Predicted) |
| vapor pressure | 4.6Pa at 20℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Tetrahydrofuran |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | 200ng/L at 20℃ |
| InChI | InChI=1S/C14H12Cl2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H,9-10H2 |
| InChIKey | INZDTEICWPZYJM-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(CCl)C=C2)=CC=C(CCl)C=C1 |
| LogP | 4.61 at 25℃ |
| CAS DataBase Reference | 1667-10-3(CAS DataBase Reference) |
Description and Uses
4,4'-Bis(chloromethyl)-1,1'-biphenyl is used as a reagent in the synthesis of new double quaternary ammonium salts containing a biphenyl moiety, which have antimicrobial and antifungal activity.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 29039990 |
