A8377932
98% , 677010-20-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB214.40 | In Stock |
|
| 1G | RMB534.40 | In Stock |
|
| 5g | RMB2187.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| Boiling point: | 627.7±55.0 °C(Predicted) |
| Density | 1.488±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | 3.36±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C15H10O6/c16-13(17)9-3-1-8(2-4-9)10-5-11(14(18)19)7-12(6-10)15(20)21/h1-7H,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | LQEZHWGJSWHXPJ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(C(O)=O)C=C2)=CC(C(O)=O)=CC(C(O)=O)=C1 |
Description and Uses
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H400 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50 |
| Safety Statements | 26-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2917.39.7000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![[1,1'-Biphenyl]-3,3',5,5'-tetracarbaldehyde](https://img.chemicalbook.com/CAS/20180529/GIF/150443-85-9.gif)
