A1288812
2-Bromophenylacetic acid , 98% , 18698-97-0
CAS NO.：18698-97-0
Empirical Formula: C8H7BrO2
Molecular Weight: 215.04
MDL number: MFCD00004314
EINECS: 242-509-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB67.20 | In Stock |
|
| 100G | RMB244.00 | In Stock |
|
| 500G | RMB1128.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-106 °C(lit.) |
| Boiling point: | 252.95°C (rough estimate) |
| Density | 1.5313 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Very faint turbidity in methanol. |
| pka | pK1: 4.054 (25°C) |
| form | Crystalline Powder, Crystals and/or Chunks |
| color | White to light beige |
| BRN | 2250655 |
| InChI | InChI=1S/C8H7BrO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | DWXSYDKEWORWBT-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC=C1Br |
| CAS DataBase Reference | 18698-97-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Bromophenylacetic acid (18698-97-0) |
Description and Uses
2-Bromophenylacetic acid has been used:
- as starting reagent in the synthesis of 8-methoxy-2-tetralone
- in the preparation of di-and tri-substituted 2-oxopiperazines on solid support
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
