PRODUCT Properties
| Melting point: | 145-147 °C (lit.) |
| Boiling point: | 240°C (estimate) |
| Density | 1.2143 (rough estimate) |
| refractive index | 1.4945 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol, Water |
| form | Crystalline Powder |
| pka | 4.17±0.10(Predicted) |
| color | Light pink to light brown |
| Water Solubility | Soluble in Methanol and Water. |
| BRN | 908000 |
| InChI | InChI=1S/C8H8O3/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4,9H,5H2,(H,10,11) |
| InChIKey | CCVYRRGZDBSHFU-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC=C1O |
| CAS DataBase Reference | 614-75-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneacetic acid, 2-hydroxy-(614-75-5) |
| EPA Substance Registry System | 2-Hydroxyphenylacetic acid (614-75-5) |
Description and Uses
2-Hydroxyphenylacetic Acid is an intermediate in the synthesis of atenolol and 3,4-dihydroxyphenylacetic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29182990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







