PRODUCT Properties
| Melting point: | 126-127 °C |
| Boiling point: | 416.1±14.0 °C(Predicted) |
| Density | 1.478±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.12±0.10(Predicted) |
| Appearance | Light brown to brown Solid |
| InChI | InChI=1S/C8H8O4/c9-6-1-5(3-8(11)12)2-7(10)4-6/h1-2,4,9-10H,3H2,(H,11,12) |
| InChIKey | IOVOJJDSFSXJQN-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC(O)=CC(O)=C1 |
| CAS DataBase Reference | 4670-09-1(CAS DataBase Reference) |
Description and Uses
3,5-Dihydroxyphenyl Acetic Acid is involved in the discovery of KLS-13019, a cannabidiol-derived neuroprotective agent. A major metabolite of myricetin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |





