A4791612
2-Hydroxyphenethyl alcohol , ≥98% , 7768-28-7
CAS NO.:7768-28-7
Empirical Formula: C8H10O2
Molecular Weight: 138.16
MDL number: MFCD00002890
EINECS: 231-863-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB67.20 | In Stock |
|
| 5G | RMB237.60 | In Stock |
|
| 25g | RMB943.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 168-169 °C2 mm Hg(lit.) |
| Density | 1.159 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, DMSO (Slightly), Methanol (Slightly) |
| pka | 10.24±0.30(Predicted) |
| form | Viscous Liquid |
| color | Clear yellow to yellow-brownish |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C8H10O2/c9-6-5-7-3-1-2-4-8(7)10/h1-4,9-10H,5-6H2 |
| InChIKey | ABFCOJLLBHXNOU-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=CC=C1O |
| LogP | 1.310 (est) |
Description and Uses
2-Hydroxybenzeneethanol can be used to synthesize cyclic products and organoaluminim oligomers. Inelastic electron tunnelling spectra of 2-hydroxyphenethyl alcohol adsorbed on thin-film aluminium and magnesium oxide has been investigated.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41-36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 2 |
| HS Code | 29072990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |






