A1289012
4-Bromo-2-fluorobenzonitrile , 99% , 105942-08-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB57.60 | In Stock |
|
| 25G | RMB133.60 | In Stock |
|
| 100G | RMB399.20 | In Stock |
|
| 500g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-72 °C |
| Boiling point: | 238-239°C |
| Density | 1.7286 (rough estimate) |
| refractive index | 1.5320 (estimate) |
| Flash point: | 238-239°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder or Chunks |
| color | White to light brown |
| Water Solubility | insoluble |
| BRN | 4231143 |
| InChI | InChI=1S/C7H3BrFN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H |
| InChIKey | HGXWRDPQFZKOLZ-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(Br)C=C1F |
| CAS DataBase Reference | 105942-08-3(CAS DataBase Reference) |
Description and Uses
4-Bromo-2-fluorobenzonitrile is used as a OLED intermediate, Pharmaceutical, electronic and chemical intermediate. It is used in the synthesis of heterocycles and liquid crystals.
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335-H301-H331 |
| Precautionary statements | P304+P340-P501a-P261-P280-P305+P351+P338-P264-P270-P301+P310+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P405-P501 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-22-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| REACH Registrations | Active |
| Limited Quantities | 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
