PRODUCT Properties
| Melting point: | 78-81 °C (lit.) |
| Boiling point: | 130°C |
| Density | 1.4412 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 7.28±0.50(Predicted) |
| form | Crystalline Powder |
| color | Off-white to beige or brown-purple |
| BRN | 2044001 |
| InChI | InChI=1S/C10H7BrO/c11-10-8-4-2-1-3-7(8)5-6-9(10)12/h1-6,12H |
| InChIKey | FQJZPYXGPYJJIH-UHFFFAOYSA-N |
| SMILES | C1(Br)=C2C(C=CC=C2)=CC=C1O |
| CAS DataBase Reference | 573-97-7(CAS DataBase Reference) |
Description and Uses
1-Bromo-2-naphthol is a dye intermediate used in organic synthesis. This product is also an anthelmintic used for hookworm infections.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | QL3361000 |
| HazardClass | IRRITANT |
| HS Code | 29081000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




