A1296412
1-Boc-3-(methylamino)piperidine , 97% , 392331-89-4
Synonym(s):
3-(Methylamino)piperidine-1-carboxylic acid tert-butyl ester
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB68.80 | In Stock |
|
| 1G | RMB170.40 | In Stock |
|
| 5G | RMB564.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 95-99℃/0.6mm |
| Density | 0.983 g/cm3 at 25 °C |
| refractive index | n20/D1.467 |
| Flash point: | >110℃ |
| storage temp. | 2-8°C |
| form | liquid |
| pka | 10.10±0.20(Predicted) |
| color | Colourless |
| InChI | 1S/C11H22N2O2/c1-11(2,3)15-10(14)13-7-5-6-9(8-13)12-4/h9,12H,5-8H2,1-4H3 |
| InChIKey | XRRRUOWSHGFPTI-UHFFFAOYSA-N |
| SMILES | CNC1CCCN(C1)C(=O)OC(C)(C)C |
| CAS DataBase Reference | 392331-89-4(CAS DataBase Reference) |
Description and Uses
Reactant for synthesis of:
- TRPV1 antagonists
- Aminopiperidines as iNOS inhibitors
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS09,GHS07 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335-H400 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P273-P301+P310-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,N,T |
| Risk Statements | 36/37/38-50-25 |
| Safety Statements | 26-36/37/39-61-45 |
| RIDADR | UN 2810 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 2933399990 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






![(1S,4S)-tert-Butyl2,5-diazabicyclo[2.2.2]octane-2-carboxylatehydrochloride](https://img.chemicalbook.com/CAS/GIF/944086-67-3.gif)
![1-BOC-3-[1-(4-FLUORO-BENZYL)-1H-BENZOIMIDAZOL-2-YLAMINO]-PIPERIDINE](https://img.chemicalbook.com/CAS/GIF/885270-89-3.gif)
