![2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine](https://img.chemicalbook.com/CAS/GIF/128249-70-7.gif)
A1299512
2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine , 98% , 128249-70-7
Synonym(s):
(R,R)-2,6-Bis(4,5-dihydro-4-phenyl-2-oxazolyl)pyridine;(R,R)-2,6-Bis(4-phenyl-2-oxazolinyl)pyridine
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB107.20 | In Stock |
|
| 1G | RMB231.20 | In Stock |
|
| 5g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-175 °C(lit.) |
| alpha | 185 º (c=1, methylene chloride) |
| Boiling point: | 600.4±55.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystal |
| pka | 3.07±0.70(Predicted) |
| color | white |
| optical activity | [α]22/D 187°, c = 1 in methylene chloride |
| Water Solubility | Insoluble |
| InChI | InChI=1S/C23H19N3O2/c1-3-8-16(9-4-1)20-14-27-22(25-20)18-12-7-13-19(24-18)23-26-21(15-28-23)17-10-5-2-6-11-17/h1-13,20-21H,14-15H2/t20-,21-/m0/s1 |
| InChIKey | HLHBIMJNCKZZQO-SFTDATJTSA-N |
| SMILES | C1(C2=N[C@H](C3=CC=CC=C3)CO2)=NC(C2=N[C@H](C3=CC=CC=C3)CO2)=CC=C1 |
| CAS DataBase Reference | 128249-70-7(CAS DataBase Reference) |
Description and Uses
2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine [Pybox] may be used as a chiral ligand in the copper-catalyzed enatioselective arylation of N-arylated tetrahydroisoquinolines (THIQs) with arylboronic acids in the presence of a photoredox catalyst.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 29339900 |
