A1300112
6-Bromo-2-pyridinecarboxaldehyde , 97% , 34160-40-2
CAS NO.:34160-40-2
Empirical Formula: C6H4BrNO
Molecular Weight: 186.01
MDL number: MFCD02683546
EINECS: 608-952-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB104.80 | In Stock |
|
| 25G | RMB422.40 | In Stock |
|
| 100g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-85 °C(lit.) |
| Boiling point: | 248.2±20.0 °C(Predicted) |
| Density | 1.683±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Dichloromethane, Ether, Ethyl Acetate, Methanol (Slightl |
| form | Powder |
| pka | 1.00±0.10(Predicted) |
| color | White to beige or pale brown |
| Water Solubility | Soluble in dichloromethane, ether, ethyl acetate and methanol. Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 1524300 |
| InChI | InChI=1S/C6H4BrNO/c7-6-3-1-2-5(4-9)8-6/h1-4H |
| InChIKey | QWFHFNGMCPMOCD-UHFFFAOYSA-N |
| SMILES | C1(C=O)=NC(Br)=CC=C1 |
| CAS DataBase Reference | 34160-40-2(CAS DataBase Reference) |
Description and Uses
6-Bromopyridine-2-carboxaldehyde is used in the study of a rhodium-catalyzed, reductive aldol coupling with divinyl ketones leading to syn ?-hydroxyenones. It is also used as a building block for Tris[(pyridyl)methyl]amine ligands.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn,F |
| Risk Statements | 36/37/38-20/21/22-10 |
| Safety Statements | 26-36-36/37/39-16 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







