A1301212
(S)-(+)-1,1'-Binaphthyl-2,2'-diyl Bis(trifluoromethanesulfonate) , 95% , 128544-05-8
CAS NO.：128544-05-8
Empirical Formula: C22H12F6O6S2
Molecular Weight: 550.45
MDL number: MFCD00274615
| Pack Size | Price | Stock | Quantity |
| 1G | RMB71.20 | In Stock |
|
| 5G | RMB342.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-85 °C(lit.) |
| alpha | 145 º (c=1, CHCL3) |
| Boiling point: | 578.8±50.0 °C(Predicted) |
| Density | 1.5402 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder |
| color | white |
| optical activity | Consistent with structure |
| Water Solubility | Insoluble |
| Sensitive | moisture sensitive |
| InChIKey | XGDOBGQPPCKMSO-PXDREZHHNA-N |
| SMILES | [C@@]1(C2(O)C3C(C=CC=C3)=CC=C2C(F)(F)(F)S(O)(=O)=O)(O)C2C(C=CC=C2)=CC=C1C(F)(F)(F)S(O)(=O)=O |&1:0,r| |
| CAS DataBase Reference | 128544-05-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501-P280-P305+P351+P338-P310 |
| Hazard Codes | C,Xi,Xn |
| Risk Statements | 34-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29072990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
