A1301912
N-Boc-O-benzyl-D-threonine , 98% , 69355-99-3
Synonym(s):
Boc-O-benzyl-D -threonine;Boc-D-Thr(Bzl)-OH;N-α-t.-Boc-O-benzyl-D-threonine / (2R,3S)
| Pack Size | Price | Stock | Quantity |
| 1G | RMB121.60 | In Stock |
|
| 5G | RMB396.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-117°C |
| Boiling point: | 461.5±45.0 °C(Predicted) |
| Density | 1.152±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Solid |
| pka | 3.50±0.10(Predicted) |
| color | White to off-white |
| optical activity | -20.2° (C=1.00 g/100ml ETOH) |
| BRN | 7339503 |
| Major Application | peptide synthesis |
| InChI | 1S/C16H23NO5/c1-11(21-10-12-8-6-5-7-9-12)13(14(18)19)17-15(20)22-16(2,3)4/h5-9,11,13H,10H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | CTXPLTPDOISPTE-WCQYABFASA-N |
| SMILES | N(C(C(OCc1ccccc1)C)C(=O)O)C(=O)OC(C)(C)C |
| CAS DataBase Reference | 69355-99-3(CAS DataBase Reference) |
Description and Uses
Boc-D-Thr(Bzl)-OH, is an amino acid derivative that can be used in the synthesis of millepachine amino acid prodrugs with enhanced solubility as antitumor agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| Storage Class | 11 - Combustible Solids |





