A1229112
Boc-D-Ser-OH , 98% , 6368-20-3
Synonym(s):
Boc-D -serine;Boc-D-Ser-OH;N-α-t.-Boc-D-serine
CAS NO.:6368-20-3
Empirical Formula: C8H15NO5
Molecular Weight: 205.21
MDL number: MFCD00063142
EINECS: 444-670-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB114.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 91-95 °C(lit.) |
| alpha | 8.5 º (c=1 H2O) |
| Boiling point: | 343.88°C (rough estimate) |
| Density | 1.2977 (rough estimate) |
| refractive index | 1.4540 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.62±0.10(Predicted) |
| color | White |
| optical activity | 13.09°(C=0.4243g/100mI, DMF, 20°C, 589nm) |
| Water Solubility | almost transparency |
| BRN | 1874714 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H15NO5/c1-8(2,3)14-7(13)9-5(4-10)6(11)12/h5,10H,4H2,1-3H3,(H,9,13)(H,11,12)/t5-/m1/s1 |
| InChIKey | FHOAKXBXYSJBGX-RXMQYKEDSA-N |
| SMILES | C(O)(=O)[C@@H](CO)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 6368-20-3(CAS DataBase Reference) |
Description and Uses
Boc-D-serine is D-serine (S270975) with amine protected from eletrophiles by tert-butyloxycarbonyl group in organic synthesis. Boc-D-serine can be used to synthesize acetamido-methoxypropionamides such as Desacetyl Desmethyl Lacosamide (D288325) which is a potent anticonvulsant.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H311-H331-H341 |
| Precautionary statements | P201-P202-P261-P264-P270-P271-P280-P302+P352-P304+P340-P308+P313-P310-P330-P361-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 13 - Non Combustible Solids |








