A8351312
L-Valine methyl ester hydrochloride , 99% , 6306-52-1
CAS NO.:6306-52-1
Empirical Formula: C6H14ClNO2
Molecular Weight: 167.63
MDL number: MFCD00012497
EINECS: 228-620-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10g | RMB30.40 | In Stock |
|
| 25G | RMB33.60 | In Stock |
|
| 100G | RMB71.20 | In Stock |
|
| 500g | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-173 °C(lit.) |
| alpha | 15.5 º (C=2,H2O 24 ºC) |
| refractive index | 15.5 ° (C=2, H2O) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | White |
| optical activity | [α]/D +15°, c = 2 in H2O |
| BRN | 3594960 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | peptide synthesis |
| InChI | InChI=1/C6H13NO2.ClH/c1-4(2)5(7)6(8)9-3;/h4-5H,7H2,1-3H3;1H/t5-;/s3 |
| InChIKey | KUGLDBMQKZTXPW-NUBCRITNSA-N |
| SMILES | [C@H](N)(C(C)C)C(=O)OC.Cl |&1:0,r| |
| CAS DataBase Reference | 6306-52-1(CAS DataBase Reference) |
Description and Uses
L-Valine Methyl Ester Hydrochloride is used in the synthesis of Valaciclovir (V085000), the L-Valine ester prodrug of Acyclovir (A192400), orally active acyclic nucleoside with inhibitory activity towards several herpes viruses. Antiviral.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29224995 |
| Storage Class | 11 - Combustible Solids |







