A1301950
4-MethylumbelliferylBeta-D-lactoside , 98% , 84325-23-5
Synonym(s):
4-Methylumbelliferyl β-D -lactoside
CAS NO.:84325-23-5
Empirical Formula: C22H28O13
Molecular Weight: 500.45
MDL number: MFCD00083406
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB479.20 | In Stock |
|
| 25mg | RMB1599.20 | In Stock |
|
| 50mg | RMB2719.20 | In Stock |
|
| 100mg | RMB4479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >178°C (dec.) |
| storage temp. | -20°C |
| solubility | DMF: soluble |
| form | Solid |
| color | White to Off-White |
| Water Solubility | water: 9.80-10.20mg/mL, clear, colorless to faintly yellow |
| BRN | 8094402 |
| InChIKey | PRTGXBPFDYMIJH-LTRTYOHLNA-N |
| SMILES | C12OC(C=C(C)C=1C=CC(O[C@H]1[C@H](O)[C@H]([C@H](O[C@H]3[C@H](O)[C@H]([C@@H](O)[C@@H](CO)O3)O)[C@@H](CO)O1)O)=C2)=O |&1:11,12,14,15,17,18,20,21,23,28,r| |
Description and Uses
4-Methylumbelliferyl-β-D-lactoside (CAS# 84325-23-5) is a fluorescent coumarin glycoside, used in the preparation of fluorescent probes for sialidases and sialyltransferases.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25-22 |
| WGK Germany | 3 |
| F | 8-10 |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |







