A1304512
Boc-Cys(Acm)-OH , 98% , 19746-37-3
Synonym(s):
Boc-S-acetamidomethyl-L -cysteine;Boc-Cys(Acm)-OH;N-α-t.-Boc-S-acetamidomethyl-L-cysteine
CAS NO.：19746-37-3
Empirical Formula: C11H20N2O5S
Molecular Weight: 292.35
MDL number: MFCD00038252
EINECS: 243-267-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB76.80 | In Stock |
|
| 25G | RMB353.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111-114 °C |
| Boiling point: | 531.5±50.0 °C(Predicted) |
| Density | 1.231±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystaline |
| pka | 3.54±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 36.5±1.5°, c = 1% in H2O |
| BRN | 2058303 |
| Major Application | peptide synthesis |
| InChI | 1S/C11H20N2O5S/c1-7(14)12-6-19-5-8(9(15)16)13-10(17)18-11(2,3)4/h8H,5-6H2,1-4H3,(H,12,14)(H,13,17)(H,15,16)/t8-/m0/s1 |
| InChIKey | HLCTYBOTPCIHTG-QMMMGPOBSA-N |
| SMILES | CC(=O)NCSC[C@H](NC(=O)OC(C)(C)C)C(O)=O |
| CAS DataBase Reference | 19746-37-3(CAS DataBase Reference) |
Description and Uses
Boc-Cys(Acm)-OH, is a Cystine derivative, used in various chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
