A1304750
Methyl2,2,3,3-tetrafluoro-3-methoxypropionate , 97% , 755-73-7
CAS NO.：755-73-7
Empirical Formula: C5H6F4O3
Molecular Weight: 190.09
MDL number: MFCD01757080
EINECS: 212-048-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB43.20 | In Stock |
|
| 25g | RMB136.80 | In Stock |
|
| 100g | RMB373.60 | In Stock |
|
| 500g | RMB1223.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 159℃ |
| Density | 1.331 |
| refractive index | 1.3327 |
| Flash point: | 48℃ |
| form | liquid |
| color | Clear |
| InChI | InChI=1S/C5H6F4O3/c1-11-3(10)4(6,7)5(8,9)12-2/h1-2H3 |
| InChIKey | NDNOUXQCMAHOSA-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(F)(F)C(F)(F)OC |
| EPA Substance Registry System | Methyl 2,2,3,3-tetrafluoro-3-methoxypropionate (755-73-7) |
Description and Uses
Methyl 2,2,3,3-tetrafluoro-3-methoxypropionate belongs to carboxylate organic compounds and can be used as an intermediate in organic synthesis.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P280 |
| HS Code | 2918999090 |
