A1304812
Boc-Gln(Trt)-OH , 98% , 132388-69-3
Synonym(s):
Nα-Boc-Nδ-trityl-L -glutamine;Boc-Gln(Trt)-OH;N-α-t.-Boc-γ-trityl-L-glutamine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB249.60 | In Stock |
|
| 100g | RMB863.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-116 °C |
| Boiling point: | 728.9±60.0 °C(Predicted) |
| Density | 1.188±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.84±0.10(Predicted) |
| Appearance | White to off-white Solid |
| BRN | 4340082 |
| Major Application | peptide synthesis |
| InChIKey | YEXNCDUSVVLUFM-DEOSSOPVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)NC(c1ccccc1)(c2ccccc2)c3ccccc3)C(O)=O |
| CAS DataBase Reference | 132388-69-3(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







