A1253512
Boc-L-alanine , 98% , 15761-38-3
Synonym(s):
Boc-Ala-OH;N-α-t.-Boc-L-alanine;N-β-t.-Boc-β-alanine;N-(tert-Butoxycarbonyl)-L -alanine;Boc-?-Ala-OH
CAS NO.:15761-38-3
Empirical Formula: C8H15NO4
Molecular Weight: 189.21
MDL number: MFCD00037225
EINECS: 239-847-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB79.20 | In Stock |
|
| 250G | RMB196.00 | In Stock |
|
| 500g | RMB389.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-83 °C(lit.) |
| Boiling point: | 324.46°C (rough estimate) |
| alpha | -26 º (c=2, acetic acid) |
| Density | 1.2321 (rough estimate) |
| refractive index | -25.5 ° (C=2, AcOH) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO, Methanol |
| pka | 4.02±0.10(Predicted) |
| form | Granular Powder |
| color | White |
| optical activity | [α]20/D 25±1°, c = 2% in acetic acid |
| BRN | 1726365 |
| InChI | InChI=1S/C8H15NO4/c1-5(6(10)11)9-7(12)13-8(2,3)4/h5H,1-4H3,(H,9,12)(H,10,11)/t5-/m0/s1 |
| InChIKey | QVHJQCGUWFKTSE-YFKPBYRVSA-N |
| SMILES | C(O)(=O)[C@H](C)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 15761-38-3(CAS DataBase Reference) |
| EPA Substance Registry System | L-Alanine, N-[(1,1-dimethylethoxy)carbonyl]- (15761-38-3) |
Description and Uses
Boc-Ala-OH can be used:
- In the preparation of N-propargylalanine, a key precursor to generate N-(3-aryl)propylated alanine residues.
- In the resolution of racemic mixture of 3,3′-bis(benzyloxy)-1,1′-binaphthalene-2,2′-diol.
- In the one-pot synthesis of hybrid tripeptidomimetics containing both amide and imide functionalities.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2924 19 00 |
| HazardClass | IRRITANT |







