A1226012
Boc-Val-OH , 99% , 13734-41-3
Synonym(s):
(S)-2-(Boc-amino)-3-methylbutyric acid;N-(tert-Butoxycarbonyl)-L -valine;Boc-L -valine;Boc-Val-OH;N-α-t.-Boc-L-valine
CAS NO.:13734-41-3
Empirical Formula: C10H19NO4
Molecular Weight: 217.26
MDL number: MFCD00065605
EINECS: 237-307-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB84.80 | In Stock |
|
| 100G | RMB216.00 | In Stock |
|
| 500G | RMB716.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-80 °C(lit.) |
| alpha | -6.3 º (c=1,CH3COOH) |
| Boiling point: | 357.82°C (rough estimate) |
| Density | 1.1518 (rough estimate) |
| vapor pressure | 0.002Pa at 25℃ |
| refractive index | -6.5 ° (C=1, AcOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, DMF, DMSO, Methanol |
| pka | 4.01±0.10(Predicted) |
| form | Fine Crystalline Powder |
| color | White |
| optical activity | [α]20/D 6.2±0.5°, c = 1% in acetic acid |
| Water Solubility | insoluble |
| BRN | 1711290 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H19NO4/c1-6(2)7(8(12)13)11-9(14)15-10(3,4)5/h6-7H,1-5H3,(H,11,14)(H,12,13)/t7-/m0/s1 |
| InChIKey | SZXBQTSZISFIAO-ZETCQYMHSA-N |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(O)=O |
| LogP | 1.752 at 25℃ |
| CAS DataBase Reference | 13734-41-3(CAS DataBase Reference) |
| EPA Substance Registry System | L-Valine, N-[(1,1-dimethylethoxy)carbonyl]- (13734-41-3) |
Description and Uses
N-Boc-L-valine is used in the multi-peptide synthesis and serves as the amino acid protection monomer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2924 19 00 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |







