A6280412
<i>N</i>-(<i>tert</i>-Butoxycarbonyl)-<small>D</small>-<i>tert</i>-leucine , >98.0%(HPLC) , 124655-17-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB31.20 | In Stock |
|
| 1G | RMB71.20 | In Stock |
|
| 5G | RMB287.20 | In Stock |
|
| 25g | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-121°C |
| Boiling point: | 350.0±25.0 °C(Predicted) |
| Density | 1.063±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | slightly sol. in Methanol |
| pka | 4.03±0.10(Predicted) |
| form | Solid |
| color | White to Almost white |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C11H21NO4/c1-10(2,3)7(8(13)14)12-9(15)16-11(4,5)6/h7H,1-6H3,(H,12,15)(H,13,14)/t7-/m0/s1 |
| InChIKey | LRFZIPCTFBPFLX-ZETCQYMHSA-N |
| SMILES | C(O)(=O)[C@@H](C(C)(C)C)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 124655-17-0(CAS DataBase Reference) |
Description and Uses
N-Boc-D-tert-leucine is a protected form of D-tert-leucine, and is used in the synthesis of primary amino acid derivatives (e.g. Desacetyl Desmethyl Lacosamide [D288325]) that possess anticonvulsant and neuropathic pain protection properties.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 |
| HazardClass | IRRITANT |
| HS Code | 2924190090 |
