A1306312
Boc-Ser-OMe , 95% , 2766-43-0
Synonym(s):
N-(tert-Butoxycarbonyl)-L -serine methyl ester;Boc-L -serine methyl ester
CAS NO.:2766-43-0
Empirical Formula: C9H17NO5
Molecular Weight: 219.24
MDL number: MFCD00191869
EINECS: 690-499-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB27.20 | In Stock |
|
| 25G | RMB68.00 | In Stock |
|
| 100G | RMB238.40 | In Stock |
|
| 500g | RMB1052.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -18 º (c=5 in methanol) |
| Boiling point: | 354.3±32.0 °C(Predicted) |
| Density | 1.082 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 10.70±0.46(Predicted) |
| form | Liquid or Oil |
| color | Colorless to yellow |
| optical activity | [α]20/D 18°, c = 5 in methanol |
| Water Solubility | Slightly soluble in water. |
| BRN | 3545389 |
| Major Application | peptide synthesis |
| InChI | 1S/C9H17NO5/c1-9(2,3)15-8(13)10-6(5-11)7(12)14-4/h6,11H,5H2,1-4H3,(H,10,13)/t6-/m0/s1 |
| InChIKey | SANNKFASHWONFD-LURJTMIESA-N |
| SMILES | COC(=O)[C@H](CO)NC(=O)OC(C)(C)C |
| CAS DataBase Reference | 2766-43-0(CAS DataBase Reference) |
Description and Uses
Boc-L-serine methyl ester is a derivative of L-Serine Methyl Ester Hydrochloride (S271005) derivative. Boc-L-serine methyl ester is an amino acid derivative used in the preparation of Tn antigen, L-glutamic acid p-nitroanilide analogs and new biomedical polymers having Serine and Threonine side groups.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 10 - Combustible liquids |






