A4698612
L-Homoserine , 98% , 672-15-1
Synonym(s):
(S)-2-Amino-4-hydroxybutyric acid;Hse;L-(-)-Homoserine
CAS NO.:672-15-1
Empirical Formula: C4H9NO3
Molecular Weight: 119.12
MDL number: MFCD00063090
EINECS: 211-590-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB90.40 | In Stock |
|
| 25G | RMB344.00 | In Stock |
|
| 100G | RMB1187.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203 °C (dec.)(lit.) |
| Boiling point: | 222.38°C (rough estimate) |
| alpha | -8.5 º (c=2, H2O 22 ºC) |
| Density | 1.3126 (rough estimate) |
| refractive index | 1.4183 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | 1100g/l |
| form | Crystalline Powder |
| pka | 2.71(at 25℃) |
| color | White to light yellow |
| optical activity | -8.825 (H2O) +18.326 (2 mol dm-3 HCl) |
| Water Solubility | 1100 g/L (30 ºC) |
| Merck | 14,4739 |
| BRN | 1721681 |
| InChI | 1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m0/s1 |
| InChIKey | UKAUYVFTDYCKQA-VKHMYHEASA-N |
| SMILES | [N+H3][C@@H](CCO)C(=O)[O-] |
| LogP | -1.289 (est) |
| CAS DataBase Reference | 672-15-1(CAS DataBase Reference) |
Description and Uses
L-Homoserine is used in the biosynthesis of methionine, threonine and isoleucine. It is also used as an internal standard for neurotransmitter analysis and amino acids quantification.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-44-35-26-28-7-4-3/9 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29225000 |
| Storage Class | 11 - Combustible Solids |







