S8897114
≥97%(HPLC) , 100938-10-1
Synonym(s):
(2S,3R)-3-Amino-2-hydroxy-5-methylhexanoyl-Val-Val-Asp hydrochloride hydrate
CAS NO.:100938-10-1
Empirical Formula: C21H39ClN4O8
Molecular Weight: 511.01
MDL number: MFCD00058071
EINECS: 999-999-2
| Pack Size | Price | Stock | Quantity |
| 0.5MG | RMB1328.88 | In Stock |
|
| 1mg | RMB2016.82 | In Stock |
|
| 5mg | RMB7282.62 | In Stock |
|
| 10mg | RMB12172.66 | In Stock |
|
| 25mg | RMB25480.26 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 202-205 °C |
| storage temp. | -20°C |
| solubility | methanol: 5 mg/mL, clear, colorless |
| form | White to off-white powder. |
| color | White to off-white |
| biological source | synthetic (organic) |
| BRN | 8888370 |
| InChIKey | WBYDQJQQTMJMQH-AFROIDPFSA-N |
| SMILES | Cl[H].[H]O[H].CC(C)C[C@@H](N)[C@H](O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(O)=O)C(O)=O |
Description and Uses
Amastatin is a slow, tight binding, competitive aminopeptidase (AP) inhibitor, first described as an inhibitor of human serum AP-A (glutamyl AP; IC50 = 0.54 μg/ml) but not of AP-B (arginine AP). It also inhibits AP-N (AP-M, alanyl AP; Ki = 20-200 nM), leucyl-cystinyl AP (Ki = 20-220 nM), and endoplasmic reticulum AP 1 (Ki = 41.8 μM). Amastatin is without effect on trypsin, papain, chymotrypsin, elastase, pepsin, or thermolysin.[Cayman Chemical]
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2924190090 |
| Storage Class | 11 - Combustible Solids |






