A1308912
Boc-4-Amino-L-phenylalanine , 98% , 55533-24-9
Synonym(s):
Boc-4-amino-L -phenylalanine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.00 | In Stock |
|
| 1G | RMB64.80 | In Stock |
|
| 5G | RMB228.80 | In Stock |
|
| 25G | RMB999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-126℃ |
| Boiling point: | 484.9±40.0 °C(Predicted) |
| Density | 1.213±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.74±0.10(Predicted) |
| color | White to off-white |
| optical activity | 25.6°(C=0.01g/mL, MEOH, 20°C, 589nm) |
| Major Application | peptide synthesis |
| InChI | 1S/C14H20N2O4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-4-6-10(15)7-5-9/h4-7,11H,8,15H2,1-3H3,(H,16,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | NDMVQEZKACRLDP-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(N)cc1)C(O)=O |
| CAS DataBase Reference | 55533-24-9(CAS DataBase Reference) |
Description and Uses
Boc-4-Amino-L-phenylalanine is an intermediate used in the synthesis of biotinylated amino acids.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-28 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |
