A1311712
Boc-D-Chg-OH , 98% , 70491-05-3
Synonym(s):
Boc-D -α-cyclohexylglycine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB120.00 | In Stock |
|
| 25G | RMB372.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75°C(lit.) |
| Boiling point: | 407.9±28.0 °C(Predicted) |
| Density | 1.111±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform, Dichloromethane, DMSO, Ethyl Acetate |
| form | Solid |
| pka | 4.01±0.10(Predicted) |
| color | Off-White |
| optical activity | Consistent with structure |
| BRN | 7689661 |
| InChI | InChI=1/C13H23NO4/c1-13(2,3)18-12(17)14-10(11(15)16)9-7-5-4-6-8-9/h9-10H,4-8H2,1-3H3,(H,14,17)(H,15,16)/t10-/s3 |
| InChIKey | QSUXZIPXYDQFCX-SNVBAGLBSA-N |
| SMILES | C1(CCCCC1)[C@H](C(=O)O)NC(=O)OC(C)(C)C |&1:6,r| |
| CAS DataBase Reference | 70491-05-3(CAS DataBase Reference) |
Description and Uses
Intermediate in the preparation of Ximelagatran.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
