A1311912
BOC-D-Homophenylalanine , ≥98.0%(HPLC) , 82732-07-8
Synonym(s):
(R)-2-(Boc-amino)-4-phenylbutyric acid;Boc-D -homophenylalanine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB36.80 | In Stock |
|
| 1G | RMB55.20 | In Stock |
|
| 5G | RMB237.60 | In Stock |
|
| 25G | RMB1023.20 | In Stock |
|
| 100g | RMB2936.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-78℃ |
| Boiling point: | 439.6±38.0 °C(Predicted) |
| Density | 1.139 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.95±0.10(Predicted) |
| form | Powder |
| color | White to off-white |
| optical activity | [α]/D -6.5±1.0°, c = 2 in ethanol |
| Water Solubility | Slightly soluble in water. |
| BRN | 3653505 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H21NO4/c1-15(2,3)20-14(19)16-12(13(17)18)10-9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/m1/s1 |
| InChIKey | MCODLPJUFHPVQP-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 82732-07-8(CAS DataBase Reference) |
Description and Uses
(R)-2-(Boc-amino)-4-phenylbutyric acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H319-H304-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P331-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P310-P403+P235-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |






