A1314812
(S,S)-(+)-N,N′-Bis(3,5-di-tert-butylsalicylidene) -1,2-cyclohexanediamine , 98% , 135616-36-3
Synonym(s):
(S,S)-Jacobsen’s ligand
| Pack Size | Price | Stock | Quantity |
| 1G | RMB75.20 | In Stock |
|
| 5G | RMB249.60 | In Stock |
|
| 25g | RMB3967.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-206 °C(lit.) |
| alpha | +305° (c 1, CH2Cl2) |
| Boiling point: | 619.74°C (rough estimate) |
| Density | 1.0110 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 13.06±0.40(Predicted) |
| form | Powder |
| color | yellow |
| optical activity | [α]20/D +315 to 15°, c = 1 in methylene chloride |
| BRN | 5464823 |
| InChIKey | FYNXDGNCEBQLGC-GTHUDTLPSA-N |
| SMILES | [C@H]1(/N=C/C2=CC(C(C)(C)C)=CC(C(C)(C)C)=C2O)CCCC[C@@H]1/N=C/C1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1O |
Description and Uses
(S,S)-(+)-N,N′-Bis(3,5-di-tert-butylsalicylidene)-1,2-cyclohexanediamine is a chiral salen-type ligand used for preparing Jacobsen′s catalyst suitable for enantioselective epoxidation of olefins lacking functional groups.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![(S,S)-[N,N'-Bis(3,5-di-tert-butylsalicylidene)-1,2-cyclohexanediamine]manganese(III)chloride](https://img.chemicalbook.com/CAS/GIF/135620-04-1.gif)


