A1316412
4-Benzyloxy-3-chlorophenylboronic acid , 98% , 845551-44-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB84.00 | In Stock |
|
| 5G | RMB318.40 | In Stock |
|
| 25g | RMB1208.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-193 °C (lit.) |
| Boiling point: | 450.2±55.0 °C(Predicted) |
| Density | 1.30±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 7.67±0.17(Predicted) |
| color | White to Almost white |
| InChI | 1S/C13H12BClO3/c15-12-8-11(14(16)17)6-7-13(12)18-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2 |
| InChIKey | AYSMMNDQVZAXQY-UHFFFAOYSA-N |
| SMILES | OB(O)c1ccc(OCc2ccccc2)c(Cl)c1 |
| CAS DataBase Reference | 845551-44-2(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
