N,O-Bis(trimethylsilyl)trifluoroacetamide with trimethylchlorosilane , 97%BSTFA+1%TMCS, used for GC derivatives , 25561-30-2
Synonym(s):
BSTFA;Bis(trimethylsilyl)trifluoroacetamide;BSTFA + TMCS;Silylating mixture V;N,O-Bis(trimethylsilyl)trifluoroacetamide
CAS NO.:25561-30-2
Empirical Formula: C8H18F3NOSi2
Molecular Weight: 257.4
MDL number: MFCD00008269
EINECS: 247-103-9
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB231.20 | In Stock |
|
| 25ML | RMB799.20 | In Stock |
|
| 100ML | RMB2319.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | -10°C |
| Boiling point: | 45-50 °C14 mm Hg(lit.) |
| Density | 0.97 g/mL(lit.) |
| refractive index | n |
| Flash point: | 75 °C |
| storage temp. | 2-8°C |
| solubility | Miscible with chloroform. |
| form | Liquid |
| pka | 1.82±0.50(Predicted) |
| Specific Gravity | 0.971 |
| color | Colorless to pale yellow |
| Water Solubility | hydrolyses |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| BRN | 3607620 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C8H18F3NOSi2/c1-14(2,3)12-7(8(9,10)11)13-15(4,5)6/h1-6H3/b12-7+ |
| InChIKey | XCOBLONWWXQEBS-KPKJPENVSA-N |
| SMILES | C[Si](C)(C)O\C(=N\[Si](C)(C)C)C(F)(F)F |
| CAS DataBase Reference | 25561-30-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Bis(trimethylsilyl)trifluoroacetamide(25561-30-2) |
Description and Uses
N,O-bis(trimethylsilyl)-trifluoroacetamide (BSTFA) is similar to BSA in specificity of modification and there are several studies which have used both reagents.One study found BSTFA superior to BSA in product stability and yield of derivative. Another study compared several trimethylsilyl donors for end-capping of silica and observed that BSTFA was more reactive than BSA but less reactive than TMCim. Both BSA and BSTFA were used to prepare trimethylsilyl derivatives of pyrimidines and purines.Current work has used BSTFA for metabolomics analysis of urine,for the measurement of khatamines (psychoactive amines of khat (Catha edulis Forsk), and for the measurement of acrylamide in cocoa.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302-H314 |
| Precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,F,T |
| Risk Statements | 11-34-10-35-14 |
| Safety Statements | 26-36/37/39-45-16 |
| RIDADR | UN 2924 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Flammable/Moisture Sensitive |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29310095 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1A |








