A7828512
TMS-BA , Used for GC derivatives , 10416-59-8
Synonym(s):
BSA;N,O-Bis(trimethylsilyl)acetamide
CAS NO.:10416-59-8
Empirical Formula: C8H21NOSi2
Molecular Weight: 203.43
MDL number: MFCD00008270
EINECS: 233-892-7
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB254.40 | In Stock |
|
| 25ML | RMB1143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 24 °C |
| Boiling point: | 71-73 °C35 mm Hg(lit.) |
| Density | 0.832 g/mL at 20 °C(lit.) |
| vapor pressure | 10 hPa (50 °C) |
| refractive index | n |
| Flash point: | 53 °F |
| storage temp. | Store below +30°C. |
| solubility | Miscible with many nonpolar and polar aprotic solvents. |
| pka | 5.82±0.50(Predicted) |
| form | Crystalline Powder, Crystals and/or Chunks |
| Specific Gravity | 0.832 |
| color | Light yellow or beige to brown |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1306669 |
| InChI | 1S/C8H21NOSi2/c1-8(9-11(2,3)4)10-12(5,6)7/h1-7H3/b9-8+ |
| InChIKey | SIOVKLKJSOKLIF-CMDGGOBGSA-N |
| SMILES | C\C(O[Si](C)(C)C)=N/[Si](C)(C)C |
| CAS DataBase Reference | 10416-59-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanimidic acid, N-(trimethylsilyl)-, trimethylsilyl ester(10416-59-8) |
| EPA Substance Registry System | Ethanimidic acid, N-(trimethylsilyl)-, trimethylsilyl ester (10416-59-8) |
Description and Uses
N,O-bis(trimethylsilyl)-acetamide (BSA) is frequently used with TMCS as a catalyst to modify a variety of functional groups including carboxyl groups. In one novel application, BSA was used to measure carboxypeptidase activity by forming derivatives which could be determined by gas chromatography.BSA has been used to prepare derivatives of steroids and glucocorticoids.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H302-H314 |
| Precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xn,F |
| Risk Statements | 10-14-22-34-40-20/21/22-11 |
| Safety Statements | 26-36/37/39-45-7/8-43A-36-30-23-16-7/9 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| RTECS | AK3000000 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29310095 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Flam. Liq. 3 Skin Corr. 1B |
| Toxicity | LD50 orally in Rabbit: 1580 mg/kg |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





