PRODUCT Properties
| Melting point: | 199-201 °C(lit.) |
| Boiling point: | 275.9°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | crystal |
| color | light yellow |
| Sensitive | Air & Moisture Sensitive |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/2C5H5.Ru/c2*1-2-4-5-3-1;/h2*1-5H; |
| InChIKey | BKEJVRMLCVMJLG-UHFFFAOYSA-N |
| SMILES | [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Ru] |^1:0,1,2,3,4,5,6,7,8,9| |
| CAS DataBase Reference | 1287-13-4(CAS DataBase Reference) |
Description and Uses
Intermediate for high-temperature compounds and for UV radiation absorbers in paints.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29310099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






