A4295112
Ferrocene , 99% , 102-54-5
Synonym(s):
Bis(cyclopentadienyl)iron;Di(cyclopentadienyl)iron;Dicyclopentadienyliron, Iron dicyclopentadienyl;Ferrocene
CAS NO.:102-54-5
Empirical Formula: C10H10Fe
Molecular Weight: 186.03
MDL number: MFCD00001427
EINECS: 203-039-3
| Pack Size | Price | Stock | Quantity |
| 25g | RMB30.40 | In Stock |
|
| 100G | RMB37.60 | In Stock |
|
| 500G | RMB95.20 | In Stock |
|
| 2.5KG | RMB439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-174 °C (lit.) |
| Boiling point: | 249 °C (lit.) |
| Density | 1.490 |
| bulk density | 500kg/m3 |
| vapor pressure | 0.03 mm Hg ( 40 °C) |
| Flash point: | 100°C |
| storage temp. | Store below +30°C. |
| solubility | insoluble in H2O; soluble in ethanol, ethyl ether,benzene, dilute HNO
3 |
| form | crystal |
| color | orange |
| Water Solubility | practically insoluble |
| Sensitive | Air & Moisture Sensitive |
| λmax | 358 nm |
| Sublimation | 100 ºC |
| Merck | 14,4037 |
| Exposure limits | ACGIH: TWA 10 mg/m3; TWA 1 mg/m3 OSHA: TWA 15 mg/m3; TWA 5 mg/m3 NIOSH: TWA 10 mg/m3; TWA 5 mg/m3; TWA 1 mg/m3 |
| Stability: | Stable at room temperature. Incompatible with strong oxidizing agents. Highly flammable. |
| InChI | 1S/2C5H5.Fe/c2*1-2-4-5-3-1;/h2*1-5H; |
| InChIKey | DFRHTHSZMBROSH-UHFFFAOYSA-N |
| SMILES | [Fe].[CH]1[CH][CH][CH][CH]1.[CH]2[CH][CH][CH][CH]2 |
| LogP | 3.711 at 22℃ |
| CAS DataBase Reference | 102-54-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Ferrocene(102-54-5) |
| EPA Substance Registry System | Ferrocene (102-54-5) |
Description and Uses
In ultraviolet stabilizers and smoke depressants for polymers; to increase the burn rate of rocket propellants; to prevent erosion of space capsule shields; to improve the viscosity of lubricants; to catalyze polymerization reactions; to catalyze combustion; some derivatives used as hematinic agents
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H228-H302+H332-H360FD-H373-H410 |
| Precautionary statements | P202-P210-P273-P301+P312-P304+P340+P312-P308+P313 |
| target organs | Liver |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,Xn,N |
| Risk Statements | 11-22-51/53-2017/11/22 |
| Safety Statements | 61-22-24/25 |
| RIDADR | UN 1325 4.1/PG 2 |
| OEB | B |
| OEL | TWA: 10 mg/m3 (total) |
| WGK Germany | 2 |
| RTECS | LK0700000 |
| Autoignition Temperature | >150 °C |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 29310095 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 1 Flam. Sol. 1 Repr. 1B STOT RE 2 Inhalation |
| Hazardous Substances Data | 102-54-5(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 1320 mg/kg LD50 dermal Rat > 3000 mg/kg |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |









