A0648712
Acetylferrocene , 95% , 1271-55-2
Synonym(s):
(Acetylcyclopentadienyl)cyclopentadienyliron;1-Ferrocenylethanone;Acetoferrocene
CAS NO.:1271-55-2
Empirical Formula: C12H12FeO10*
Molecular Weight: 228.07
MDL number: MFCD00001432
EINECS: 215-043-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.80 | In Stock |
|
| 5G | RMB56.00 | In Stock |
|
| 25G | RMB180.00 | In Stock |
|
| 100G | RMB683.20 | In Stock |
|
| 250g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-83 °C (lit.) |
| Boiling point: | 160-163 °C (3.0004 mmHg) |
| Density | >1 g/cm3 (20℃) |
| Flash point: | 160-163°C/4mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | Needle-Like Crystalline Powder |
| color | Orange |
| Water Solubility | insoluble |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, reducing agents, strong acids, strong bases. |
| InChI | InChI=1S/C7H7O.C5H5.Fe/c1-6(8)7-4-2-3-5-7;1-2-4-5-3-1;/h2-5H,1H3;1-5H; |
| InChIKey | PHMAOJNZIFULOG-UHFFFAOYSA-N |
| SMILES | [C]1(C(=O)C)[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe] |^1:0,4,5,6,7,8,9,10,11,12| |
| CAS DataBase Reference | 1271-55-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetylferrocene(1271-55-2) |
| EPA Substance Registry System | Ferrocene, acetyl- (1271-55-2) |
Description and Uses
1-Acetylferrocene was originally used in military or space field as an additive in rocket propellant, to promote the burning rate. Its ferrocenyl derivative has wide applications to biological and medical fields such as ferrocene-modified beta-lactam because of its physiological activity of anti-malarial, anti-tumor, bactericidal, anti-inflammatory, treatment of anemia, inhibition of enzymatic activity and so on by virtue of its unique structure and diverse properties.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310 |
| Precautionary statements | P262-P264-P270-P280-P301+P310-P302+P352+P310 |
| Hazard Codes | T+ |
| Risk Statements | 28 |
| Safety Statements | 28-36/37-45-28A-1 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | OB3700000 |
| F | 10 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29310095 |
| Toxicity | LDLo orl-rat: 5 mg/kg EPASR* 8EHQ-1285-0578 |






