A1319812
1-Boc-hexahydro-1,4-diazepine , ≥96% , 112275-50-0
Synonym(s):
tert-Butyl homopiperazine-1-carboxylate;1-Boc-homopiperazine
CAS NO.:112275-50-0
Empirical Formula: C10H20N2O2
Molecular Weight: 200.28
MDL number: MFCD00276987
EINECS: 628-955-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB51.20 | In Stock |
|
| 5G | RMB136.00 | In Stock |
|
| 25G | RMB597.60 | In Stock |
|
| 100G | RMB2221.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143.4 °C |
| Boiling point: | 95-110 °C0.5 mm Hg(lit.) |
| Density | 1.016 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 10.45±0.20(Predicted) |
| form | Liquid |
| Specific Gravity | 1.016 |
| color | Colorless to yellow |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Air Sensitive |
| BRN | 7581789 |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-7-4-5-11-6-8-12/h11H,4-8H2,1-3H3 |
| InChIKey | WDPWEXWMQDRXAL-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCNCC1 |
| CAS DataBase Reference | 112275-50-0(CAS DataBase Reference) |
Description and Uses
1-Boc-homopiperazine is used in synthesis of potent anticoagulant. It is also used to produce 4-(7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)-[1,4]diazepane-1-carboxylic acid tert-butyl ester by reaction with 11-bromo-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2735 |
| WGK Germany | 3 |
| F | 10-34 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, KEEP COLD |
| HazardClass | 8 |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






