A1321512
1-Boc-3-Hydroxypyrrolidine , 98% , 103057-44-9
CAS NO.:103057-44-9
Empirical Formula: C9H17NO3
Molecular Weight: 187.24
MDL number: MFCD04038535
EINECS: 600-388-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB559.20 | In Stock |
|
| 500g | RMB2719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62.1-62.2°C |
| Boiling point: | 273.3±33.0 °C(Predicted) |
| Density | 1.142±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.74±0.20(Predicted) |
| color | White to Almost white |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C9H17NO3/c1-9(2,3)13-8(12)10-5-4-7(11)6-10/h7,11H,4-6H2,1-3H3 |
| InChIKey | APCBTRDHCDOPNY-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(O)C1 |
| CAS DataBase Reference | 103057-44-9(CAS DataBase Reference) |
Description and Uses
1-Boc-3-pyrrolidinol is an intermediate for the preparation of pyrrolidinone-containing pseudopeptides, inhibitors of HIV-1 protease.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-36/37/39-37-45-36/37 |
| RIDADR | 2811 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







