BD9468531
tert-Butyl 3-methyleneazetidine-1-carboxylate , 97% , 934664-41-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB78.40 | In Stock |
|
| 5g | RMB284.80 | In Stock |
|
| 10g | RMB430.40 | In Stock |
|
| 25g | RMB762.40 | In Stock |
|
| 100g | RMB2149.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 214.8±29.0 °C(Predicted) |
| Density | 1.02±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | clear liquid |
| pka | -1.56±0.20(Predicted) |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C9H15NO2/c1-7-5-10(6-7)8(11)12-9(2,3)4/h1,5-6H2,2-4H3 |
| InChIKey | MECAHFSQQZQZOI-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CC(=C)C1 |
Description and Uses
tert-Butyl 3-Methyleneazetidine-1-carboxylate is a useful reagent used in the preparation of functionalized difluorocyclopropanes as building blocks for drug discoveries.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| HS Code | 2933998090 |
